| Name | m-toluidinium chloride |
| Synonyms | m-ToluidineHCl m-toluidiniumchloride m-toluidinium chloride m-Toluidine hydrochloride m-Toluidine Hydrochloride M-TOLUIDINE HYDROCHLORIDE 3-Toluidine Hydrochloride META-TOLUIDINEHYDROCHLORIDE 3-methylanilinehydrochloride 3-methyl-benzenaminhydrochloride |
| CAS | 638-03-9 |
| EINECS | 211-314-4 |
| InChI | InChI=1S/C7H9N.ClH/c1-6-3-2-4-7(8)5-6;/h2-5H,8H2,1H3;1H |
| Molecular Formula | C7H10ClN |
| Molar Mass | 143.61 |
| Density | 1.0968 (rough estimate) |
| Melting Point | 227.9°C |
| Boling Point | 234.4°C (rough estimate) |
| Water Solubility | Soluble in water |
| Appearance | Solid:particulate/powder |
| Color | White to Almost white |
| Storage Condition | Room Temprature |
| Stability | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Refractive Index | 1.5760 (estimate) |
| MDL | MFCD00070607 |
| RTECS | XU7175000 |
| EPA chemical substance information | information is provided by: ofmpeb.epa.gov (external link) |